C23H33NO2Si — CID 100983675
N-[(Z,6S)-6-[tert-butyl(diphenyl)silyl]oxyhept-4-enyl]hydroxylamine (PubChem CID 100983675) has the molecular formula C23H33NO2Si and a molecular weight of 383.61 g/mol. Its IUPAC name is N-[(Z,6S)-6-[tert-butyl(diphenyl)silyl]oxyhept-4-enyl]hydroxylamine.
| Compound Name | N-[(Z,6S)-6-[tert-butyl(diphenyl)silyl]oxyhept-4-enyl]hydroxylamine |
|---|---|
| PubChem CID | 100983675 |
| Molecular Formula | C23H33NO2Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | N-[(Z,6S)-6-[tert-butyl(diphenyl)silyl]oxyhept-4-enyl]hydroxylamine |
| SMILES | C[C@@H](/C=C\CCCNO)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H33NO2Si/c1-20(14-8-7-13-19-24-25)26-27(23(2,3)4,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h5-6,8-12,14-18,20,24-25H,7,13,19H2,1-4H3/b14-8-/t20-/m0/s1 |
| InChIKey | YVIAIDGBQKAMTG-UEOBAOCASA-N |
| XLogP | 4.27 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|