C32H41NOSi — CID 134870970
(E,2R)-N-benzyl-2-[tert-butyl(diphenyl)silyl]oxynon-3-en-1-imine (PubChem CID 134870970) has the molecular formula C32H41NOSi and a molecular weight of 483.77 g/mol. Its IUPAC name is (E,2R)-N-benzyl-2-[tert-butyl(diphenyl)silyl]oxynon-3-en-1-imine.
| Compound Name | (E,2R)-N-benzyl-2-[tert-butyl(diphenyl)silyl]oxynon-3-en-1-imine |
|---|---|
| PubChem CID | 134870970 |
| Molecular Formula | C32H41NOSi |
| Molecular Weight | 483.77 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | (E,2R)-N-benzyl-2-[tert-butyl(diphenyl)silyl]oxynon-3-en-1-imine |
| SMILES | CCCCC/C=C/[C@H](/C=N/Cc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H41NOSi/c1-5-6-7-8-14-21-29(27-33-26-28-19-12-9-13-20-28)34-35(32(2,3)4,30-22-15-10-16-23-30)31-24-17-11-18-25-31/h9-25,27,29H,5-8,26H2,1-4H3/b21-14+,33-27+/t29-/m1/s1 |
| InChIKey | GBSUMDLDJSEROU-WBBFCGGCSA-N |
| XLogP | 7.34 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.77 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|