C33H42O2Si — CID 10553404
(3R,8S,9Z)-3-[tert-butyl(diphenyl)silyl]oxyheptadeca-1,9-dien-4,6-diyn-8-ol (PubChem CID 10553404) has the molecular formula C33H42O2Si and a molecular weight of 498.78 g/mol. Its IUPAC name is (3R,8S,9Z)-3-[tert-butyl(diphenyl)silyl]oxyheptadeca-1,9-dien-4,6-diyn-8-ol.
| Compound Name | (3R,8S,9Z)-3-[tert-butyl(diphenyl)silyl]oxyheptadeca-1,9-dien-4,6-diyn-8-ol |
|---|---|
| PubChem CID | 10553404 |
| Molecular Formula | C33H42O2Si |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | (3R,8S,9Z)-3-[tert-butyl(diphenyl)silyl]oxyheptadeca-1,9-dien-4,6-diyn-8-ol |
| SMILES | C=C[C@H](C#CC#C[C@@H](O)/C=C\CCCCCCC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H42O2Si/c1-6-8-9-10-11-12-15-22-29(34)23-20-21-24-30(7-2)35-36(33(3,4)5,31-25-16-13-17-26-31)32-27-18-14-19-28-32/h7,13-19,22,25-30,34H,2,6,8-12H2,1,3-5H3/b22-15-/t29-,30+/m0/s1 |
| InChIKey | QHUZARVHXDCBPD-ZLODHHJQSA-N |
| XLogP | 6.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|