C29H40O3Si — CID 135030913
(E,5R,6S)-1-[tert-butyl(diphenyl)silyl]oxytridec-3-en-7-yne-5,6-diol (PubChem CID 135030913) has the molecular formula C29H40O3Si and a molecular weight of 464.72 g/mol. Its IUPAC name is (E,5R,6S)-1-[tert-butyl(diphenyl)silyl]oxytridec-3-en-7-yne-5,6-diol.
| Compound Name | (E,5R,6S)-1-[tert-butyl(diphenyl)silyl]oxytridec-3-en-7-yne-5,6-diol |
|---|---|
| PubChem CID | 135030913 |
| Molecular Formula | C29H40O3Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (E,5R,6S)-1-[tert-butyl(diphenyl)silyl]oxytridec-3-en-7-yne-5,6-diol |
| SMILES | CCCCCC#C[C@H](O)[C@H](O)/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H40O3Si/c1-5-6-7-8-15-22-27(30)28(31)23-16-17-24-32-33(29(2,3)4,25-18-11-9-12-19-25)26-20-13-10-14-21-26/h9-14,16,18-21,23,27-28,30-31H,5-8,17,24H2,1-4H3/b23-16+/t27-,28+/m0/s1 |
| InChIKey | FCCKLPFNBOLKKY-FEQGGDCVSA-N |
| XLogP | 4.81 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|