C26H33Cl3O2Si — CID 132507154
(4R)-10-[tert-butyl(diphenyl)silyl]oxy-1,3,3-trichlorodec-5-yn-4-ol (PubChem CID 132507154) has the molecular formula C26H33Cl3O2Si and a molecular weight of 511.99 g/mol. Its IUPAC name is (4R)-10-[tert-butyl(diphenyl)silyl]oxy-1,3,3-trichlorodec-5-yn-4-ol.
| Compound Name | (4R)-10-[tert-butyl(diphenyl)silyl]oxy-1,3,3-trichlorodec-5-yn-4-ol |
|---|---|
| PubChem CID | 132507154 |
| Molecular Formula | C26H33Cl3O2Si |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (4R)-10-[tert-butyl(diphenyl)silyl]oxy-1,3,3-trichlorodec-5-yn-4-ol |
| SMILES | CC(C)(C)[Si](OCCCCC#C[C@@H](O)C(Cl)(Cl)CCCl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H33Cl3O2Si/c1-25(2,3)32(22-14-8-6-9-15-22,23-16-10-7-11-17-23)31-21-13-5-4-12-18-24(30)26(28,29)19-20-27/h6-11,14-17,24,30H,4-5,13,19-21H2,1-3H3/t24-/m1/s1 |
| InChIKey | HNBMUTQGDGMORB-XMMPIXPASA-N |
| XLogP | 5.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|