C31H38O2Si — CID 10412453
tert-butyl-[8-(4-methoxyphenyl)oct-7-ynoxy]-diphenylsilane (PubChem CID 10412453) has the molecular formula C31H38O2Si and a molecular weight of 470.73 g/mol. Its IUPAC name is tert-butyl-[8-(4-methoxyphenyl)oct-7-ynoxy]-diphenylsilane.
| Compound Name | tert-butyl-[8-(4-methoxyphenyl)oct-7-ynoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10412453 |
| Molecular Formula | C31H38O2Si |
| Molecular Weight | 470.73 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | tert-butyl-[8-(4-methoxyphenyl)oct-7-ynoxy]-diphenylsilane |
| SMILES | COc1ccc(C#CCCCCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H38O2Si/c1-31(2,3)34(29-18-12-9-13-19-29,30-20-14-10-15-21-30)33-26-16-8-6-5-7-11-17-27-22-24-28(32-4)25-23-27/h9-10,12-15,18-25H,5-8,16,26H2,1-4H3 |
| InChIKey | ZMMMTGSNFWRDPI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|