C33H41BrO3Si — CID 22164963
[4-(9-bromonon-1-ynyl)-2,6-dimethoxyphenoxy]-tert-butyl-diphenylsilane (PubChem CID 22164963) has the molecular formula C33H41BrO3Si and a molecular weight of 593.68 g/mol. Its IUPAC name is [4-(9-bromonon-1-ynyl)-2,6-dimethoxyphenoxy]-tert-butyl-diphenylsilane.
| Compound Name | [4-(9-bromonon-1-ynyl)-2,6-dimethoxyphenoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 22164963 |
| Molecular Formula | C33H41BrO3Si |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | [4-(9-bromonon-1-ynyl)-2,6-dimethoxyphenoxy]-tert-butyl-diphenylsilane |
| SMILES | COc1cc(C#CCCCCCCCBr)cc(OC)c1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H41BrO3Si/c1-33(2,3)38(28-20-14-11-15-21-28,29-22-16-12-17-23-29)37-32-30(35-4)25-27(26-31(32)36-5)19-13-9-7-6-8-10-18-24-34/h11-12,14-17,20-23,25-26H,6-10,18,24H2,1-5H3 |
| InChIKey | OBAWXAAJTCEZAG-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|