C26H35BrO2P2Si — CID 91177193
bromo-[[3-[tert-butyl(diphenyl)silyl]oxy-4-methoxyphenyl]methyl]-phosphanylphosphane;ethane (PubChem CID 91177193) has the molecular formula C26H35BrO2P2Si and a molecular weight of 549.50 g/mol. Its IUPAC name is bromo-[[3-[tert-butyl(diphenyl)silyl]oxy-4-methoxyphenyl]methyl]-phosphanylphosphane;ethane.
| Compound Name | bromo-[[3-[tert-butyl(diphenyl)silyl]oxy-4-methoxyphenyl]methyl]-phosphanylphosphane;ethane |
|---|---|
| PubChem CID | 91177193 |
| Molecular Formula | C26H35BrO2P2Si |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | bromo-[[3-[tert-butyl(diphenyl)silyl]oxy-4-methoxyphenyl]methyl]-phosphanylphosphane;ethane |
| SMILES | CC.COc1ccc(CP(P)Br)cc1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H29BrO2P2Si.C2H6/c1-24(2,3)30(20-11-7-5-8-12-20,21-13-9-6-10-14-21)27-23-17-19(18-29(25)28)15-16-22(23)26-4;1-2/h5-17H,18,28H2,1-4H3;1-2H3 |
| InChIKey | GOBYJVFBRUFZOY-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|