C33H35BrO4Si — CID 11635755
[5-[(E)-2-(3-bromo-4,5-dimethoxyphenyl)ethenyl]-2-methoxyphenoxy]-tert-butyl-diphenylsilane (PubChem CID 11635755) has the molecular formula C33H35BrO4Si and a molecular weight of 603.63 g/mol. Its IUPAC name is [5-[(E)-2-(3-bromo-4,5-dimethoxyphenyl)ethenyl]-2-methoxyphenoxy]-tert-butyl-diphenylsilane.
| Compound Name | [5-[(E)-2-(3-bromo-4,5-dimethoxyphenyl)ethenyl]-2-methoxyphenoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11635755 |
| Molecular Formula | C33H35BrO4Si |
| Molecular Weight | 603.63 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | [5-[(E)-2-(3-bromo-4,5-dimethoxyphenyl)ethenyl]-2-methoxyphenoxy]-tert-butyl-diphenylsilane |
| SMILES | COc1ccc(/C=C/c2cc(Br)c(OC)c(OC)c2)cc1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H35BrO4Si/c1-33(2,3)39(26-13-9-7-10-14-26,27-15-11-8-12-16-27)38-30-22-24(19-20-29(30)35-4)17-18-25-21-28(34)32(37-6)31(23-25)36-5/h7-23H,1-6H3/b18-17+ |
| InChIKey | WHEJSSIWTROCJZ-ISLYRVAYSA-N |
| XLogP | 7.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.63 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|