C24H32O6Si — CID 50900668
tert-butyl-[5-[(Z)-2-(4,7-dimethoxy-1,3-benzodioxol-5-yl)ethenyl]-2-methoxyphenoxy]-dimethylsilane (PubChem CID 50900668) has the molecular formula C24H32O6Si and a molecular weight of 444.60 g/mol. Its IUPAC name is tert-butyl-[5-[(Z)-2-(4,7-dimethoxy-1,3-benzodioxol-5-yl)ethenyl]-2-methoxyphenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[5-[(Z)-2-(4,7-dimethoxy-1,3-benzodioxol-5-yl)ethenyl]-2-methoxyphenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 50900668 |
| Molecular Formula | C24H32O6Si |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | tert-butyl-[5-[(Z)-2-(4,7-dimethoxy-1,3-benzodioxol-5-yl)ethenyl]-2-methoxyphenoxy]-dimethylsilane |
| SMILES | COc1ccc(/C=C\c2cc(OC)c3c(c2OC)OCO3)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H32O6Si/c1-24(2,3)31(7,8)30-19-13-16(10-12-18(19)25-4)9-11-17-14-20(26-5)22-23(21(17)27-6)29-15-28-22/h9-14H,15H2,1-8H3/b11-9- |
| InChIKey | ICPCSMQJATZHGM-LUAWRHEFSA-N |
| XLogP | 6.00 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|