C20H19BrO7 — CID 171132036
1-(4-bromo-6,7-dimethoxy-1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 171132036) has the molecular formula C20H19BrO7 and a molecular weight of 451.27 g/mol. Its IUPAC name is 1-(4-bromo-6,7-dimethoxy-1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(4-bromo-6,7-dimethoxy-1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 171132036 |
| Molecular Formula | C20H19BrO7 |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 1-(4-bromo-6,7-dimethoxy-1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2c(Br)c3c(c(OC)c2OC)OCO3)cc1OC |
| InChI | InChI=1S/C20H19BrO7/c1-23-13-8-6-11(9-14(13)24-2)5-7-12(22)15-16(21)18-20(28-10-27-18)19(26-4)17(15)25-3/h5-9H,10H2,1-4H3 |
| InChIKey | YEZVWVCZABOWAV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|