C33H32O7 — CID 10816288
(E)-1-[2,4-dimethoxy-3,6-bis(phenylmethoxy)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 10816288) has the molecular formula C33H32O7 and a molecular weight of 540.61 g/mol. Its IUPAC name is (E)-1-[2,4-dimethoxy-3,6-bis(phenylmethoxy)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2,4-dimethoxy-3,6-bis(phenylmethoxy)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 10816288 |
| Molecular Formula | C33H32O7 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | (E)-1-[2,4-dimethoxy-3,6-bis(phenylmethoxy)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2c(OCc3ccccc3)cc(OC)c(OCc3ccccc3)c2OC)cc1OC |
| InChI | InChI=1S/C33H32O7/c1-35-27-18-16-23(19-28(27)36-2)15-17-26(34)31-29(39-21-24-11-7-5-8-12-24)20-30(37-3)32(33(31)38-4)40-22-25-13-9-6-10-14-25/h5-20H,21-22H2,1-4H3/b17-15+ |
| InChIKey | XBYPKYRYXWDEJF-BMRADRMJSA-N |
| XLogP | 6.78 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|