C50H42O7 — CID 101023378
(E)-3-[3,4-bis(phenylmethoxy)phenyl]-1-[2-hydroxy-3,4,6-tris(phenylmethoxy)phenyl](113C)prop-2-en-1-one (PubChem CID 101023378) has the molecular formula C50H42O7 and a molecular weight of 755.87 g/mol. Its IUPAC name is (E)-3-[3,4-bis(phenylmethoxy)phenyl]-1-[2-hydroxy-3,4,6-tris(phenylmethoxy)phenyl](113C)prop-2-en-1-one.
| Compound Name | (E)-3-[3,4-bis(phenylmethoxy)phenyl]-1-[2-hydroxy-3,4,6-tris(phenylmethoxy)phenyl](113C)prop-2-en-1-one |
|---|---|
| PubChem CID | 101023378 |
| Molecular Formula | C50H42O7 |
| Molecular Weight | 755.87 g/mol |
| Exact Mass | 755.30 |
| IUPAC Name | (E)-3-[3,4-bis(phenylmethoxy)phenyl]-1-[2-hydroxy-3,4,6-tris(phenylmethoxy)phenyl](113C)prop-2-en-1-one |
| SMILES | O=[13C](/C=C/c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1)c1c(OCc2ccccc2)cc(OCc2ccccc2)c(OCc2ccccc2)c1O |
| InChI | InChI=1S/C50H42O7/c51-43(28-26-37-27-29-44(53-32-38-16-6-1-7-17-38)45(30-37)54-33-39-18-8-2-9-19-39)48-46(55-34-40-20-10-3-11-21-40)31-47(56-35-41-22-12-4-13-23-41)50(49(48)52)57-36-42-24-14-5-15-25-42/h1-31,52H,32-36H2/b28-26+/i43+1 |
| InChIKey | GQQMSSHHJXAUHJ-UABRIFTPSA-N |
| XLogP | 11.18 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.87 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|