C27H28O8 — CID 143913926
(E)-1-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 143913926) has the molecular formula C27H28O8 and a molecular weight of 480.51 g/mol. Its IUPAC name is (E)-1-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 143913926 |
| Molecular Formula | C27H28O8 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | (E)-1-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2c(O)c(OC)c(OC)c(OC)c2OC)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H28O8/c1-30-21-15-17(12-14-20(21)35-16-18-9-7-6-8-10-18)11-13-19(28)22-23(29)25(32-3)27(34-5)26(33-4)24(22)31-2/h6-15,29H,16H2,1-5H3/b13-11+ |
| InChIKey | NOUUIZDKTLCLHO-ACCUITESSA-N |
| XLogP | 4.91 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|