C21H20O7 — CID 5348764
(E)-3-(3,4-dimethoxyphenyl)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)prop-2-en-1-one (PubChem CID 5348764) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5348764 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2c(O)c(OC)c3occc3c2OC)cc1OC |
| InChI | InChI=1S/C21H20O7/c1-24-15-8-6-12(11-16(15)25-2)5-7-14(22)17-18(23)21(27-4)20-13(9-10-28-20)19(17)26-3/h5-11,23H,1-4H3/b7-5+ |
| InChIKey | VBHRTYFBLFRBHN-FNORWQNLSA-N |
| XLogP | 4.07 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|