C21H22O9S — CID 142804053
ethane;[3-[(E)-3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]phenyl] hydrogen sulfate (PubChem CID 142804053) has the molecular formula C21H22O9S and a molecular weight of 450.47 g/mol. Its IUPAC name is ethane;[3-[(E)-3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]phenyl] hydrogen sulfate.
| Compound Name | ethane;[3-[(E)-3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 142804053 |
| Molecular Formula | C21H22O9S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | ethane;[3-[(E)-3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]phenyl] hydrogen sulfate |
| SMILES | CC.COc1c(C(=O)/C=C/c2cccc(OS(=O)(=O)O)c2)c(O)c(OC)c2occc12 |
| InChI | InChI=1S/C19H16O9S.C2H6/c1-25-17-13-8-9-27-18(13)19(26-2)16(21)15(17)14(20)7-6-11-4-3-5-12(10-11)28-29(22,23)24;1-2/h3-10,21H,1-2H3,(H,22,23,24);1-2H3/b7-6+; |
| InChIKey | GMGYDHUHZUSVTD-UHDJGPCESA-N |
| XLogP | 4.26 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|