C20H16F2O8S — CID 72625920
difluoro-[3-[3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]phenyl]methanesulfonic acid (PubChem CID 72625920) has the molecular formula C20H16F2O8S and a molecular weight of 454.40 g/mol. Its IUPAC name is difluoro-[3-[3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]phenyl]methanesulfonic acid.
| Compound Name | difluoro-[3-[3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 72625920 |
| Molecular Formula | C20H16F2O8S |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | difluoro-[3-[3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]phenyl]methanesulfonic acid |
| SMILES | COc1c(C(=O)C=Cc2cccc(C(F)(F)S(=O)(=O)O)c2)c(O)c(OC)c2occc12 |
| InChI | InChI=1S/C20H16F2O8S/c1-28-17-13-8-9-30-18(13)19(29-2)16(24)15(17)14(23)7-6-11-4-3-5-12(10-11)20(21,22)31(25,26)27/h3-10,24H,1-2H3,(H,25,26,27) |
| InChIKey | VQCIVJUUGAUZOL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|