C17H14F2O4 — CID 8853497
(E)-1-(2,6-difluorophenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 8853497) has the molecular formula C17H14F2O4 and a molecular weight of 320.29 g/mol. Its IUPAC name is (E)-1-(2,6-difluorophenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,6-difluorophenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8853497 |
| Molecular Formula | C17H14F2O4 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (E)-1-(2,6-difluorophenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2c(F)cccc2F)cc(OC)c1O |
| InChI | InChI=1S/C17H14F2O4/c1-22-14-8-10(9-15(23-2)17(14)21)6-7-13(20)16-11(18)4-3-5-12(16)19/h3-9,21H,1-2H3/b7-6+ |
| InChIKey | GBEGEYGTDITMAI-VOTSOKGWSA-N |
| XLogP | 3.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|