C21H22O8 — CID 87118330
3-hydroxy-4-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-2-methoxy-5,6-dimethylbenzoic acid (PubChem CID 87118330) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is 3-hydroxy-4-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-2-methoxy-5,6-dimethylbenzoic acid.
| Compound Name | 3-hydroxy-4-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-2-methoxy-5,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 87118330 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 3-hydroxy-4-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-2-methoxy-5,6-dimethylbenzoic acid |
| SMILES | COc1cc(C=CC(=O)c2c(C)c(C)c(C(=O)O)c(OC)c2O)cc(OC)c1O |
| InChI | InChI=1S/C21H22O8/c1-10-11(2)17(21(25)26)20(29-5)19(24)16(10)13(22)7-6-12-8-14(27-3)18(23)15(9-12)28-4/h6-9,23-24H,1-5H3,(H,25,26) |
| InChIKey | ORGWAHMDAYMJSE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|