C19H16Br2O6 — CID 86599972
4-[3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]-3-hydroxy-2-methoxy-5,6-dimethylbenzoic acid (PubChem CID 86599972) has the molecular formula C19H16Br2O6 and a molecular weight of 500.14 g/mol. Its IUPAC name is 4-[3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]-3-hydroxy-2-methoxy-5,6-dimethylbenzoic acid.
| Compound Name | 4-[3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]-3-hydroxy-2-methoxy-5,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 86599972 |
| Molecular Formula | C19H16Br2O6 |
| Molecular Weight | 500.14 g/mol |
| Exact Mass | 497.93 |
| IUPAC Name | 4-[3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]-3-hydroxy-2-methoxy-5,6-dimethylbenzoic acid |
| SMILES | COc1c(O)c(C(=O)C=Cc2cc(Br)c(O)c(Br)c2)c(C)c(C)c1C(=O)O |
| InChI | InChI=1S/C19H16Br2O6/c1-8-9(2)15(19(25)26)18(27-3)17(24)14(8)13(22)5-4-10-6-11(20)16(23)12(21)7-10/h4-7,23-24H,1-3H3,(H,25,26) |
| InChIKey | JBJJQLDKPGVWTR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.14 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|