C14H10Br2O2S — CID 69053115
3-(3,5-dibromo-4-hydroxyphenyl)-1-(4-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 69053115) has the molecular formula C14H10Br2O2S and a molecular weight of 402.11 g/mol. Its IUPAC name is 3-(3,5-dibromo-4-hydroxyphenyl)-1-(4-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | 3-(3,5-dibromo-4-hydroxyphenyl)-1-(4-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69053115 |
| Molecular Formula | C14H10Br2O2S |
| Molecular Weight | 402.11 g/mol |
| Exact Mass | 399.88 |
| IUPAC Name | 3-(3,5-dibromo-4-hydroxyphenyl)-1-(4-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | Cc1csc(C(=O)C=Cc2cc(Br)c(O)c(Br)c2)c1 |
| InChI | InChI=1S/C14H10Br2O2S/c1-8-4-13(19-7-8)12(17)3-2-9-5-10(15)14(18)11(16)6-9/h2-7,18H,1H3 |
| InChIKey | MAKVONCOGRNHNX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.11 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|