C11H10Br2O3 — CID 86072917
ethyl 3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoate (PubChem CID 86072917) has the molecular formula C11H10Br2O3 and a molecular weight of 350.01 g/mol. Its IUPAC name is ethyl 3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoate.
| Compound Name | ethyl 3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 86072917 |
| Molecular Formula | C11H10Br2O3 |
| Molecular Weight | 350.01 g/mol |
| Exact Mass | 347.90 |
| IUPAC Name | ethyl 3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C11H10Br2O3/c1-2-16-10(14)4-3-7-5-8(12)11(15)9(13)6-7/h3-6,15H,2H2,1H3 |
| InChIKey | DXXWKFNSXKPLBG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.01 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|