C12H12F2O3 — CID 118464785
ethyl (E)-3-[3,5-difluoro-4-(hydroxymethyl)phenyl]prop-2-enoate (PubChem CID 118464785) has the molecular formula C12H12F2O3 and a molecular weight of 242.22 g/mol. Its IUPAC name is ethyl (E)-3-[3,5-difluoro-4-(hydroxymethyl)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3,5-difluoro-4-(hydroxymethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 118464785 |
| Molecular Formula | C12H12F2O3 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | ethyl (E)-3-[3,5-difluoro-4-(hydroxymethyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(F)c(CO)c(F)c1 |
| InChI | InChI=1S/C12H12F2O3/c1-2-17-12(16)4-3-8-5-10(13)9(7-15)11(14)6-8/h3-6,15H,2,7H2,1H3/b4-3+ |
| InChIKey | ZGEDEMAVPPDASK-ONEGZZNKSA-N |
| XLogP | 2.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|