C14H16F2O2 — CID 66733998
butyl 3-(3,5-difluoro-4-methylphenyl)prop-2-enoate (PubChem CID 66733998) has the molecular formula C14H16F2O2 and a molecular weight of 254.28 g/mol. Its IUPAC name is butyl 3-(3,5-difluoro-4-methylphenyl)prop-2-enoate.
| Compound Name | butyl 3-(3,5-difluoro-4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 66733998 |
| Molecular Formula | C14H16F2O2 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | butyl 3-(3,5-difluoro-4-methylphenyl)prop-2-enoate |
| SMILES | CCCCOC(=O)C=Cc1cc(F)c(C)c(F)c1 |
| InChI | InChI=1S/C14H16F2O2/c1-3-4-7-18-14(17)6-5-11-8-12(15)10(2)13(16)9-11/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | CPTDJJXRQCASOL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|