C11H8F4O2 — CID 169480514
ethyl 3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate (PubChem CID 169480514) has the molecular formula C11H8F4O2 and a molecular weight of 248.17 g/mol. Its IUPAC name is ethyl 3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate.
| Compound Name | ethyl 3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 169480514 |
| Molecular Formula | C11H8F4O2 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | ethyl 3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H8F4O2/c1-2-17-9(16)4-3-6-10(14)7(12)5-8(13)11(6)15/h3-5H,2H2,1H3 |
| InChIKey | DVMOVMJCEBXAAB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|