C17H13Br2NO3 — CID 78787133
N-[3-[(E)-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]phenyl]acetamide (PubChem CID 78787133) has the molecular formula C17H13Br2NO3 and a molecular weight of 439.10 g/mol. Its IUPAC name is N-[3-[(E)-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]phenyl]acetamide.
| Compound Name | N-[3-[(E)-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 78787133 |
| Molecular Formula | C17H13Br2NO3 |
| Molecular Weight | 439.10 g/mol |
| Exact Mass | 436.93 |
| IUPAC Name | N-[3-[(E)-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(=O)/C=C/c2cc(Br)c(O)c(Br)c2)c1 |
| InChI | InChI=1S/C17H13Br2NO3/c1-10(21)20-13-4-2-3-12(9-13)16(22)6-5-11-7-14(18)17(23)15(19)8-11/h2-9,23H,1H3,(H,20,21)/b6-5+ |
| InChIKey | PERMJLITDIZKKT-AATRIKPKSA-N |
| XLogP | 4.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.10 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|