C10H9BrO4 — CID 735789
(E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid (PubChem CID 735789) has the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. Its IUPAC name is (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 735789 |
| Molecular Formula | C10H9BrO4 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(Br)c1O |
| InChI | InChI=1S/C10H9BrO4/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,14H,1H3,(H,12,13)/b3-2+ |
| InChIKey | NGBVBJQUJJKRGF-NSCUHMNNSA-N |
| XLogP | 2.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|