C18H16O7 — CID 162923726
3-[3-(5-formyl-2-hydroxy-3-methoxyphenyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid (PubChem CID 162923726) has the molecular formula C18H16O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 3-[3-(5-formyl-2-hydroxy-3-methoxyphenyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(5-formyl-2-hydroxy-3-methoxyphenyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162923726 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-[3-(5-formyl-2-hydroxy-3-methoxyphenyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=O)cc(-c2cc(C=CC(=O)O)cc(OC)c2O)c1O |
| InChI | InChI=1S/C18H16O7/c1-24-14-7-10(3-4-16(20)21)5-12(17(14)22)13-6-11(9-19)8-15(25-2)18(13)23/h3-9,22-23H,1-2H3,(H,20,21) |
| InChIKey | RAZNMXMTWWVONB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|