C13H14O4 — CID 69212456
3-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)prop-2-enoic acid (PubChem CID 69212456) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)prop-2-enoic acid.
| Compound Name | 3-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 69212456 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)prop-2-enoic acid |
| SMILES | C=CCc1cc(C=CC(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C13H14O4/c1-3-4-10-7-9(5-6-12(14)15)8-11(17-2)13(10)16/h3,5-8,16H,1,4H2,2H3,(H,14,15) |
| InChIKey | BWUADYZMIPGTNI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|