C11H14O2 — CID 175119671
4-ethenyl-2-ethyl-6-methoxyphenol (PubChem CID 175119671) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-ethenyl-2-ethyl-6-methoxyphenol.
| Compound Name | 4-ethenyl-2-ethyl-6-methoxyphenol |
|---|---|
| PubChem CID | 175119671 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 4-ethenyl-2-ethyl-6-methoxyphenol |
| SMILES | C=Cc1cc(CC)c(O)c(OC)c1 |
| InChI | InChI=1S/C11H14O2/c1-4-8-6-9(5-2)11(12)10(7-8)13-3/h4,6-7,12H,1,5H2,2-3H3 |
| InChIKey | BUIMVBPBQQPKOX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |