C26H34O6 — CID 86096018
5-ethenyl-2-[6-(4-ethenyl-2,6-dimethoxyphenoxy)hexoxy]-1,3-dimethoxybenzene (PubChem CID 86096018) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is 5-ethenyl-2-[6-(4-ethenyl-2,6-dimethoxyphenoxy)hexoxy]-1,3-dimethoxybenzene.
| Compound Name | 5-ethenyl-2-[6-(4-ethenyl-2,6-dimethoxyphenoxy)hexoxy]-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 86096018 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 5-ethenyl-2-[6-(4-ethenyl-2,6-dimethoxyphenoxy)hexoxy]-1,3-dimethoxybenzene |
| SMILES | C=Cc1cc(OC)c(OCCCCCCOc2c(OC)cc(C=C)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C26H34O6/c1-7-19-15-21(27-3)25(22(16-19)28-4)31-13-11-9-10-12-14-32-26-23(29-5)17-20(8-2)18-24(26)30-6/h7-8,15-18H,1-2,9-14H2,3-6H3 |
| InChIKey | WAWUTOQRZXLMJG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|