C26H44O3 — CID 132596911
5-ethenyl-1,2,3-trihexoxybenzene (PubChem CID 132596911) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is 5-ethenyl-1,2,3-trihexoxybenzene.
| Compound Name | 5-ethenyl-1,2,3-trihexoxybenzene |
|---|---|
| PubChem CID | 132596911 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 5-ethenyl-1,2,3-trihexoxybenzene |
| SMILES | C=Cc1cc(OCCCCCC)c(OCCCCCC)c(OCCCCCC)c1 |
| InChI | InChI=1S/C26H44O3/c1-5-9-12-15-18-27-24-21-23(8-4)22-25(28-19-16-13-10-6-2)26(24)29-20-17-14-11-7-3/h8,21-22H,4-7,9-20H2,1-3H3 |
| InChIKey | HMXVCXBGFDMIGY-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|