C22H24O6 — CID 162516150
(E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 162516150) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162516150 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | C=CCc1ccc(OCCOc2ccc(/C=C/C(=O)O)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C22H24O6/c1-4-5-16-6-9-18(20(14-16)25-2)27-12-13-28-19-10-7-17(8-11-22(23)24)15-21(19)26-3/h4,6-11,14-15H,1,5,12-13H2,2-3H3,(H,23,24)/b11-8+ |
| InChIKey | RFVYIRUNIITZAE-DHZHZOJOSA-N |
| XLogP | 3.99 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|