C25H28O7 — CID 162516151
propyl (E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)-2-oxoethoxy]phenyl]prop-2-enoate (PubChem CID 162516151) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is propyl (E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)-2-oxoethoxy]phenyl]prop-2-enoate.
| Compound Name | propyl (E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)-2-oxoethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 162516151 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | propyl (E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)-2-oxoethoxy]phenyl]prop-2-enoate |
| SMILES | C=CCc1ccc(OC(=O)COc2ccc(/C=C/C(=O)OCCC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C25H28O7/c1-5-7-18-9-12-21(23(15-18)29-4)32-25(27)17-31-20-11-8-19(16-22(20)28-3)10-13-24(26)30-14-6-2/h5,8-13,15-16H,1,6-7,14,17H2,2-4H3/b13-10+ |
| InChIKey | ZZOYLFJBIAGIJC-JLHYYAGUSA-N |
| XLogP | 4.38 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|