C23H24O7 — CID 162516171
methyl (E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)-2-oxoethoxy]phenyl]prop-2-enoate (PubChem CID 162516171) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is methyl (E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)-2-oxoethoxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)-2-oxoethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 162516171 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | methyl (E)-3-[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)-2-oxoethoxy]phenyl]prop-2-enoate |
| SMILES | C=CCc1ccc(OC(=O)COc2ccc(/C=C/C(=O)OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C23H24O7/c1-5-6-16-8-11-19(21(13-16)27-3)30-23(25)15-29-18-10-7-17(14-20(18)26-2)9-12-22(24)28-4/h5,7-14H,1,6,15H2,2-4H3/b12-9+ |
| InChIKey | SRSWXEPZJPPTLL-FMIVXFBMSA-N |
| XLogP | 3.60 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|