C22H26O4 — CID 142294967
(2-methyl-5-propan-2-ylphenyl) 2-(2-methoxy-4-prop-2-enylphenoxy)acetate (PubChem CID 142294967) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2-methyl-5-propan-2-ylphenyl) 2-(2-methoxy-4-prop-2-enylphenoxy)acetate.
| Compound Name | (2-methyl-5-propan-2-ylphenyl) 2-(2-methoxy-4-prop-2-enylphenoxy)acetate |
|---|---|
| PubChem CID | 142294967 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (2-methyl-5-propan-2-ylphenyl) 2-(2-methoxy-4-prop-2-enylphenoxy)acetate |
| SMILES | C=CCc1ccc(OCC(=O)Oc2cc(C(C)C)ccc2C)c(OC)c1 |
| InChI | InChI=1S/C22H26O4/c1-6-7-17-9-11-19(21(12-17)24-5)25-14-22(23)26-20-13-18(15(2)3)10-8-16(20)4/h6,8-13,15H,1,7,14H2,2-5H3 |
| InChIKey | VXVDHOKUEQFVEF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|