C18H23NO5 — CID 7804136
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-(2-methoxy-4-prop-2-enylphenoxy)acetate (PubChem CID 7804136) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-(2-methoxy-4-prop-2-enylphenoxy)acetate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-(2-methoxy-4-prop-2-enylphenoxy)acetate |
|---|---|
| PubChem CID | 7804136 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-(2-methoxy-4-prop-2-enylphenoxy)acetate |
| SMILES | C=CCc1ccc(OCC(=O)O[C@@H](C)C(=O)NC2CC2)c(OC)c1 |
| InChI | InChI=1S/C18H23NO5/c1-4-5-13-6-9-15(16(10-13)22-3)23-11-17(20)24-12(2)18(21)19-14-7-8-14/h4,6,9-10,12,14H,1,5,7-8,11H2,2-3H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | QDLILXCXMNSXAW-LBPRGKRZSA-N |
| XLogP | 2.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|