C14H15BrO4 — CID 170498399
3-[3-(4-bromobut-1-enyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid (PubChem CID 170498399) has the molecular formula C14H15BrO4 and a molecular weight of 327.17 g/mol. Its IUPAC name is 3-[3-(4-bromobut-1-enyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(4-bromobut-1-enyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170498399 |
| Molecular Formula | C14H15BrO4 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-[3-(4-bromobut-1-enyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)cc(C=CCCBr)c1O |
| InChI | InChI=1S/C14H15BrO4/c1-19-12-9-10(5-6-13(16)17)8-11(14(12)18)4-2-3-7-15/h2,4-6,8-9,18H,3,7H2,1H3,(H,16,17) |
| InChIKey | LQNIGUUNPAJBNY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|