C15H18O8 — CID 171896588
3-[3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid (PubChem CID 171896588) has the molecular formula C15H18O8 and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-[3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171896588 |
| Molecular Formula | C15H18O8 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3-[3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid |
| SMILES | COC(=O)CC(O)C(O)c1cc(C=CC(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C15H18O8/c1-22-11-6-8(3-4-12(17)18)5-9(15(11)21)14(20)10(16)7-13(19)23-2/h3-6,10,14,16,20-21H,7H2,1-2H3,(H,17,18) |
| InChIKey | CZCXOOXKHRWDEX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|