C14H18O6S — CID 171875090
3-[3-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid (PubChem CID 171875090) has the molecular formula C14H18O6S and a molecular weight of 314.36 g/mol. Its IUPAC name is 3-[3-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171875090 |
| Molecular Formula | C14H18O6S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3-[3-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)cc(C(O)C(O)CCS)c1O |
| InChI | InChI=1S/C14H18O6S/c1-20-11-7-8(2-3-12(16)17)6-9(14(11)19)13(18)10(15)4-5-21/h2-3,6-7,10,13,15,18-19,21H,4-5H2,1H3,(H,16,17) |
| InChIKey | NVQBOFTZBYXBFO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|