C19H14O6 — CID 74819196
3-(1,3-benzodioxol-5-yl)-1-(7-hydroxy-4-methoxy-1-benzofuran-5-yl)prop-2-en-1-one (PubChem CID 74819196) has the molecular formula C19H14O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-(7-hydroxy-4-methoxy-1-benzofuran-5-yl)prop-2-en-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-(7-hydroxy-4-methoxy-1-benzofuran-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 74819196 |
| Molecular Formula | C19H14O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-(7-hydroxy-4-methoxy-1-benzofuran-5-yl)prop-2-en-1-one |
| SMILES | COc1c(C(=O)C=Cc2ccc3c(c2)OCO3)cc(O)c2occc12 |
| InChI | InChI=1S/C19H14O6/c1-22-18-12-6-7-23-19(12)15(21)9-13(18)14(20)4-2-11-3-5-16-17(8-11)25-10-24-16/h2-9,21H,10H2,1H3 |
| InChIKey | YNUGACKHHNAYKR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|