C21H22O8 — CID 76771516
3-(1,3-benzodioxol-5-yl)-1-[2-methoxy-4,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one (PubChem CID 76771516) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[2-methoxy-4,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[2-methoxy-4,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 76771516 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[2-methoxy-4,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one |
| SMILES | COCOc1cc(OC)c(C(=O)C=Cc2ccc3c(c2)OCO3)c(OCOC)c1 |
| InChI | InChI=1S/C21H22O8/c1-23-11-26-15-9-19(25-3)21(20(10-15)27-12-24-2)16(22)6-4-14-5-7-17-18(8-14)29-13-28-17/h4-10H,11-13H2,1-3H3 |
| InChIKey | QAVZMURJVFMGKJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|