C22H19NO6 — CID 123501962
3-(1,3-benzodioxol-5-yl)-1-(7-methoxy-2,2-dimethyl-5-nitrosochromen-6-yl)prop-2-en-1-one (PubChem CID 123501962) has the molecular formula C22H19NO6 and a molecular weight of 393.40 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-(7-methoxy-2,2-dimethyl-5-nitrosochromen-6-yl)prop-2-en-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-(7-methoxy-2,2-dimethyl-5-nitrosochromen-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123501962 |
| Molecular Formula | C22H19NO6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-(7-methoxy-2,2-dimethyl-5-nitrosochromen-6-yl)prop-2-en-1-one |
| SMILES | COc1cc2c(c(N=O)c1C(=O)C=Cc1ccc3c(c1)OCO3)C=CC(C)(C)O2 |
| InChI | InChI=1S/C22H19NO6/c1-22(2)9-8-14-17(29-22)11-19(26-3)20(21(14)23-25)15(24)6-4-13-5-7-16-18(10-13)28-12-27-16/h4-11H,12H2,1-3H3 |
| InChIKey | PPVTVXXCEORJGF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|