C21H20O4 — CID 66571956
(E)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-(3-methoxyphenyl)prop-2-en-1-one (PubChem CID 66571956) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (E)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-(3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-(3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66571956 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (E)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-(3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)c2ccc3c(c2O)C=CC(C)(C)O3)c1 |
| InChI | InChI=1S/C21H20O4/c1-21(2)12-11-17-19(25-21)10-8-16(20(17)23)18(22)9-7-14-5-4-6-15(13-14)24-3/h4-13,23H,1-3H3/b9-7+ |
| InChIKey | ZXUXDRNFXNQOPS-VQHVLOKHSA-N |
| XLogP | 4.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|