C22H21FO4 — CID 71544850
(E)-3-(3-ethoxy-4-fluorophenyl)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)prop-2-en-1-one (PubChem CID 71544850) has the molecular formula C22H21FO4 and a molecular weight of 368.40 g/mol. Its IUPAC name is (E)-3-(3-ethoxy-4-fluorophenyl)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-ethoxy-4-fluorophenyl)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71544850 |
| Molecular Formula | C22H21FO4 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (E)-3-(3-ethoxy-4-fluorophenyl)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)prop-2-en-1-one |
| SMILES | CCOc1cc(/C=C/C(=O)c2ccc3c(c2O)C=CC(C)(C)O3)ccc1F |
| InChI | InChI=1S/C22H21FO4/c1-4-26-20-13-14(5-8-17(20)23)6-9-18(24)15-7-10-19-16(21(15)25)11-12-22(2,3)27-19/h5-13,25H,4H2,1-3H3/b9-6+ |
| InChIKey | JTDMGKPEDVEHCR-RMKNXTFCSA-N |
| XLogP | 5.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|