C26H26O5 — CID 102511796
(E)-3-(1,3-benzodioxol-5-yl)-1-[5-hydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]prop-2-en-1-one (PubChem CID 102511796) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-[5-hydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[5-hydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 102511796 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[5-hydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]prop-2-en-1-one |
| SMILES | CC(C)=CCc1cc(C(=O)/C=C/c2ccc3c(c2)OCO3)c(O)c2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C26H26O5/c1-16(2)5-8-18-14-20(24(28)19-11-12-26(3,4)31-25(18)19)21(27)9-6-17-7-10-22-23(13-17)30-15-29-22/h5-7,9-14,28H,8,15H2,1-4H3/b9-6+ |
| InChIKey | XQZPGKOIRKWRAA-RMKNXTFCSA-N |
| XLogP | 5.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|