C27H31NO4 — CID 123518143
[8-[3-[4-(diethylamino)phenyl]prop-2-enoyl]-2,2-dimethylchromen-5-yl] propanoate (PubChem CID 123518143) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is [8-[3-[4-(diethylamino)phenyl]prop-2-enoyl]-2,2-dimethylchromen-5-yl] propanoate.
| Compound Name | [8-[3-[4-(diethylamino)phenyl]prop-2-enoyl]-2,2-dimethylchromen-5-yl] propanoate |
|---|---|
| PubChem CID | 123518143 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | [8-[3-[4-(diethylamino)phenyl]prop-2-enoyl]-2,2-dimethylchromen-5-yl] propanoate |
| SMILES | CCC(=O)Oc1ccc(C(=O)C=Cc2ccc(N(CC)CC)cc2)c2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C27H31NO4/c1-6-25(30)31-24-16-14-21(26-22(24)17-18-27(4,5)32-26)23(29)15-11-19-9-12-20(13-10-19)28(7-2)8-3/h9-18H,6-8H2,1-5H3 |
| InChIKey | JJNJJLSWIJRRSK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|