C25H25NO3 — CID 90670531
(E)-3-(1-ethylindol-6-yl)-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one (PubChem CID 90670531) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is (E)-3-(1-ethylindol-6-yl)-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1-ethylindol-6-yl)-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90670531 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (E)-3-(1-ethylindol-6-yl)-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one |
| SMILES | CCn1ccc2ccc(/C=C/C(=O)c3ccc(OC)c4c3OC(C)(C)C=C4)cc21 |
| InChI | InChI=1S/C25H25NO3/c1-5-26-15-13-18-8-6-17(16-21(18)26)7-10-22(27)19-9-11-23(28-4)20-12-14-25(2,3)29-24(19)20/h6-16H,5H2,1-4H3/b10-7+ |
| InChIKey | JYPSWRWADWIVHQ-JXMROGBWSA-N |
| XLogP | 5.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|