C30H34N2O3 — CID 90670529
(E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-[1-(2-piperidin-1-ylethyl)indol-5-yl]prop-2-en-1-one (PubChem CID 90670529) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-[1-(2-piperidin-1-ylethyl)indol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-[1-(2-piperidin-1-ylethyl)indol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 90670529 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-[1-(2-piperidin-1-ylethyl)indol-5-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc3c(ccn3CCN3CCCCC3)c2)c2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C30H34N2O3/c1-30(2)15-13-25-28(34-3)12-9-24(29(25)35-30)27(33)11-8-22-7-10-26-23(21-22)14-18-32(26)20-19-31-16-5-4-6-17-31/h7-15,18,21H,4-6,16-17,19-20H2,1-3H3/b11-8+ |
| InChIKey | IQLJIPIGOJFKIM-DHZHZOJOSA-N |
| XLogP | 6.22 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|