C22H22N2O5 — CID 163710358
[5-[(E)-3-(5-hydroxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]-2-methoxyphenyl]urea (PubChem CID 163710358) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [5-[(E)-3-(5-hydroxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]-2-methoxyphenyl]urea.
| Compound Name | [5-[(E)-3-(5-hydroxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]-2-methoxyphenyl]urea |
|---|---|
| PubChem CID | 163710358 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [5-[(E)-3-(5-hydroxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]-2-methoxyphenyl]urea |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(O)c3c2OC(C)(C)C=C3)cc1NC(N)=O |
| InChI | InChI=1S/C22H22N2O5/c1-22(2)11-10-15-18(26)8-6-14(20(15)29-22)17(25)7-4-13-5-9-19(28-3)16(12-13)24-21(23)27/h4-12,26H,1-3H3,(H3,23,24,27)/b7-4+ |
| InChIKey | KIRKJJVNSFROEN-QPJJXVBHSA-N |
| XLogP | 3.97 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|